C13H21ClN2O2 — CID 106694790
[(5-chlorofuran-2-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine (PubChem CID 106694790) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is [(5-chlorofuran-2-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [(5-chlorofuran-2-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106694790 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [(5-chlorofuran-2-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
| SMILES | CC1(C)CC(C(NN)c2ccc(Cl)o2)C(C)(C)O1 |
| InChI | InChI=1S/C13H21ClN2O2/c1-12(2)7-8(13(3,4)18-12)11(16-15)9-5-6-10(14)17-9/h5-6,8,11,16H,7,15H2,1-4H3 |
| InChIKey | CGCBPNLABNUAGC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|