C16H24N4O — CID 103129985
[pyrazolo[1,5-a]pyridin-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine (PubChem CID 103129985) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is [pyrazolo[1,5-a]pyridin-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [pyrazolo[1,5-a]pyridin-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103129985 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [pyrazolo[1,5-a]pyridin-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
| SMILES | CC1(C)CC(C(NN)c2cnn3ccccc23)C(C)(C)O1 |
| InChI | InChI=1S/C16H24N4O/c1-15(2)9-12(16(3,4)21-15)14(19-17)11-10-18-20-8-6-5-7-13(11)20/h5-8,10,12,14,19H,9,17H2,1-4H3 |
| InChIKey | IQFZKIGHYWRHDL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|