C10H15N5O4S — CID 105359048
3-amino-1,5-dimethyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrazole-4-sulfonamide (PubChem CID 105359048) has the molecular formula C10H15N5O4S and a molecular weight of 301.33 g/mol. Its IUPAC name is 3-amino-1,5-dimethyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1,5-dimethyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105359048 |
| Molecular Formula | C10H15N5O4S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-amino-1,5-dimethyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)pyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NC2CC(=O)N(C)C2=O)c(N)nn1C |
| InChI | InChI=1S/C10H15N5O4S/c1-5-8(9(11)12-15(5)3)20(18,19)13-6-4-7(16)14(2)10(6)17/h6,13H,4H2,1-3H3,(H2,11,12) |
| InChIKey | BSRYSMVDFGFPIT-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|