C12H13ClN2O4S — CID 100762065
3-chloro-2-methyl-N-[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide (PubChem CID 100762065) has the molecular formula C12H13ClN2O4S and a molecular weight of 316.77 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 100762065 |
| Molecular Formula | C12H13ClN2O4S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 3-chloro-2-methyl-N-[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]benzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N[C@@H]1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C12H13ClN2O4S/c1-7-8(13)4-3-5-10(7)20(18,19)14-9-6-11(16)15(2)12(9)17/h3-5,9,14H,6H2,1-2H3/t9-/m1/s1 |
| InChIKey | IATYHGXIQZOUKO-SECBINFHSA-N |
| XLogP | 0.68 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|