C11H22BrNO2S — CID 105361768
N-[3-(bromomethyl)pentan-3-yl]cyclopentanesulfonamide (PubChem CID 105361768) has the molecular formula C11H22BrNO2S and a molecular weight of 312.27 g/mol. Its IUPAC name is N-[3-(bromomethyl)pentan-3-yl]cyclopentanesulfonamide.
| Compound Name | N-[3-(bromomethyl)pentan-3-yl]cyclopentanesulfonamide |
|---|---|
| PubChem CID | 105361768 |
| Molecular Formula | C11H22BrNO2S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-[3-(bromomethyl)pentan-3-yl]cyclopentanesulfonamide |
| SMILES | CCC(CC)(CBr)NS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C11H22BrNO2S/c1-3-11(4-2,9-12)13-16(14,15)10-7-5-6-8-10/h10,13H,3-9H2,1-2H3 |
| InChIKey | HNQXFGUDZYRWIY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|