C15H14BrNO2S — CID 105366565
2-[(3-bromo-5-methyl-2-pyridinyl)sulfanyl]-3-phenylpropanoic acid (PubChem CID 105366565) has the molecular formula C15H14BrNO2S and a molecular weight of 352.25 g/mol. Its IUPAC name is 2-[(3-bromo-5-methyl-2-pyridinyl)sulfanyl]-3-phenylpropanoic acid.
| Compound Name | 2-[(3-bromo-5-methyl-2-pyridinyl)sulfanyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 105366565 |
| Molecular Formula | C15H14BrNO2S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-[(3-bromo-5-methyl-2-pyridinyl)sulfanyl]-3-phenylpropanoic acid |
| SMILES | Cc1cnc(SC(Cc2ccccc2)C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C15H14BrNO2S/c1-10-7-12(16)14(17-9-10)20-13(15(18)19)8-11-5-3-2-4-6-11/h2-7,9,13H,8H2,1H3,(H,18,19) |
| InChIKey | FDLCCNLLUUJFHE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |