C16H26FN — CID 105375532
6-(5-fluoro-2-methylphenyl)-N,2,2-trimethylhexan-3-amine (PubChem CID 105375532) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is 6-(5-fluoro-2-methylphenyl)-N,2,2-trimethylhexan-3-amine.
| Compound Name | 6-(5-fluoro-2-methylphenyl)-N,2,2-trimethylhexan-3-amine |
|---|---|
| PubChem CID | 105375532 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 6-(5-fluoro-2-methylphenyl)-N,2,2-trimethylhexan-3-amine |
| SMILES | CNC(CCCc1cc(F)ccc1C)C(C)(C)C |
| InChI | InChI=1S/C16H26FN/c1-12-9-10-14(17)11-13(12)7-6-8-15(18-5)16(2,3)4/h9-11,15,18H,6-8H2,1-5H3 |
| InChIKey | PBQHUTAYYZFXRQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |