C13H8BrF2NO2 — CID 105391854
(4-bromophenyl)methyl 2,3-difluoropyridine-4-carboxylate (PubChem CID 105391854) has the molecular formula C13H8BrF2NO2 and a molecular weight of 328.11 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2,3-difluoropyridine-4-carboxylate.
| Compound Name | (4-bromophenyl)methyl 2,3-difluoropyridine-4-carboxylate |
|---|---|
| PubChem CID | 105391854 |
| Molecular Formula | C13H8BrF2NO2 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | (4-bromophenyl)methyl 2,3-difluoropyridine-4-carboxylate |
| SMILES | O=C(OCc1ccc(Br)cc1)c1ccnc(F)c1F |
| InChI | InChI=1S/C13H8BrF2NO2/c14-9-3-1-8(2-4-9)7-19-13(18)10-5-6-17-12(16)11(10)15/h1-6H,7H2 |
| InChIKey | OQRZJHRRSIUCBS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|