About dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate
dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate (PubChem CID 10539657) has the molecular formula C13H14O6
and a molecular weight of 266.25 g/mol. Its IUPAC name is dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate.
Analyze dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate?
The IUPAC name of dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate (CID 10539657) is dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate.
What is the SMILES notation for dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate?
The canonical SMILES for dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate is COC(=O)c1cc(O)c2c(c1C(=O)OC)OCCC2.
What is the InChIKey of dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate?
The InChIKey is ANRSMTSFMYZRHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O6/c1-17-12(15)8-6-9(14)7-4-3-5-19-11(7)10(8)13(16)18-2/h6,14H,3-5H2,1-2H3.
What are the key properties of dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate?
dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate has a molecular weight of 266.25 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-hydroxy-3,4-dihydro-2H-chromene-7,8-dicarboxylate is sourced from PubChem (CID 10539657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).