C16H16O4 — CID 102098677
methyl 11,16-dioxatricyclo[8.6.0.02,7]hexadeca-1(10),2,4,6,8-pentaene-9-carboxylate (PubChem CID 102098677) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl 11,16-dioxatricyclo[8.6.0.02,7]hexadeca-1(10),2,4,6,8-pentaene-9-carboxylate.
| Compound Name | methyl 11,16-dioxatricyclo[8.6.0.02,7]hexadeca-1(10),2,4,6,8-pentaene-9-carboxylate |
|---|---|
| PubChem CID | 102098677 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | methyl 11,16-dioxatricyclo[8.6.0.02,7]hexadeca-1(10),2,4,6,8-pentaene-9-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2c2c1OCCCCO2 |
| InChI | InChI=1S/C16H16O4/c1-18-16(17)13-10-11-6-2-3-7-12(11)14-15(13)20-9-5-4-8-19-14/h2-3,6-7,10H,4-5,8-9H2,1H3 |
| InChIKey | FWECATWWAHCZHA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |