C13H16F2O4 — CID 10540244
(2S,3R,4R,6R)-5,5-difluoro-2-methyl-6-phenylmethoxyoxane-3,4-diol (PubChem CID 10540244) has the molecular formula C13H16F2O4 and a molecular weight of 274.26 g/mol. Its IUPAC name is (2S,3R,4R,6R)-5,5-difluoro-2-methyl-6-phenylmethoxyoxane-3,4-diol.
| Compound Name | (2S,3R,4R,6R)-5,5-difluoro-2-methyl-6-phenylmethoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 10540244 |
| Molecular Formula | C13H16F2O4 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (2S,3R,4R,6R)-5,5-difluoro-2-methyl-6-phenylmethoxyoxane-3,4-diol |
| SMILES | C[C@@H]1O[C@@H](OCc2ccccc2)C(F)(F)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16F2O4/c1-8-10(16)11(17)13(14,15)12(19-8)18-7-9-5-3-2-4-6-9/h2-6,8,10-12,16-17H,7H2,1H3/t8-,10-,11+,12+/m0/s1 |
| InChIKey | KPTQGQYMWOWZLY-OHBODLIOSA-N |
| XLogP | 1.31 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |