5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid

C15H12F2O3S — CID 105407425

IUPAC5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid
SMILESCc1ccc(S(=O)Cc2cc(F)cc(F)c2)cc1C(=O)O
InChIInChI=1S/C15H12F2O3S/c1-9-2-3-13(7-14(9)15(18)19)21(20)8-10-4-11(16)6-12(17)5-10/h2-7H,8H2,1H3,(H,18,19)
InChIKeyUZJKGFFQTKLLRK-UHFFFAOYSA-N
MW310.32 g/mol
LogP3.28
Rot. Bonds4

About 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid

5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid (PubChem CID 105407425) has the molecular formula C15H12F2O3S and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid.

Molecular Properties

Compound Name5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid
PubChem CID105407425
Molecular FormulaC15H12F2O3S
Molecular Weight310.32 g/mol
Exact Mass310.05
IUPAC Name5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid
SMILESCc1ccc(S(=O)Cc2cc(F)cc(F)c2)cc1C(=O)O
InChIInChI=1S/C15H12F2O3S/c1-9-2-3-13(7-14(9)15(18)19)21(20)8-10-4-11(16)6-12(17)5-10/h2-7H,8H2,1H3,(H,18,19)
InChIKeyUZJKGFFQTKLLRK-UHFFFAOYSA-N
XLogP3.28
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.32
LogP ≤ 53.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid?
The IUPAC name of 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid (CID 105407425) is 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid.
What is the SMILES notation for 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid?
The canonical SMILES for 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid is Cc1ccc(S(=O)Cc2cc(F)cc(F)c2)cc1C(=O)O.
What is the InChIKey of 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid?
The InChIKey is UZJKGFFQTKLLRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2O3S/c1-9-2-3-13(7-14(9)15(18)19)21(20)8-10-4-11(16)6-12(17)5-10/h2-7H,8H2,1H3,(H,18,19).
What are the key properties of 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid?
5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid has a molecular weight of 310.32 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid is sourced from PubChem (CID 105407425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).