C15H12F2O3S — CID 105407425
5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid (PubChem CID 105407425) has the molecular formula C15H12F2O3S and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid.
| Compound Name | 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 105407425 |
| Molecular Formula | C15H12F2O3S |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 5-[(3,5-difluorophenyl)methylsulfinyl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(S(=O)Cc2cc(F)cc(F)c2)cc1C(=O)O |
| InChI | InChI=1S/C15H12F2O3S/c1-9-2-3-13(7-14(9)15(18)19)21(20)8-10-4-11(16)6-12(17)5-10/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | UZJKGFFQTKLLRK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |