C17H26O4 — CID 10541840
(5S,5aS,8aS,9R)-5-ethoxy-9-hydroxy-5,7,7-trimethyl-4,5a,6,8,8a,9-hexahydro-3H-azuleno[5,6-c]furan-1-one (PubChem CID 10541840) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (5S,5aS,8aS,9R)-5-ethoxy-9-hydroxy-5,7,7-trimethyl-4,5a,6,8,8a,9-hexahydro-3H-azuleno[5,6-c]furan-1-one.
| Compound Name | (5S,5aS,8aS,9R)-5-ethoxy-9-hydroxy-5,7,7-trimethyl-4,5a,6,8,8a,9-hexahydro-3H-azuleno[5,6-c]furan-1-one |
|---|---|
| PubChem CID | 10541840 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (5S,5aS,8aS,9R)-5-ethoxy-9-hydroxy-5,7,7-trimethyl-4,5a,6,8,8a,9-hexahydro-3H-azuleno[5,6-c]furan-1-one |
| SMILES | CCO[C@@]1(C)CC2=C(C(=O)OC2)[C@H](O)[C@H]2CC(C)(C)C[C@@H]21 |
| InChI | InChI=1S/C17H26O4/c1-5-21-17(4)6-10-9-20-15(19)13(10)14(18)11-7-16(2,3)8-12(11)17/h11-12,14,18H,5-9H2,1-4H3/t11-,12-,14+,17-/m0/s1 |
| InChIKey | VILMWSRAKSBVQN-DIGLBZAJSA-N |
| XLogP | 2.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |