C14H17NO — CID 105422231
8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 105422231) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 105422231 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2cccc(N3CCCC3)c21 |
| InChI | InChI=1S/C14H17NO/c16-13-8-4-6-11-5-3-7-12(14(11)13)15-9-1-2-10-15/h3,5,7H,1-2,4,6,8-10H2 |
| InChIKey | QBQIUDYFPJQEDQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |