About 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one
8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 105422231) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 105422231 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2cccc(N3CCCC3)c21 |
| InChI | InChI=1S/C14H17NO/c16-13-8-4-6-11-5-3-7-12(14(11)13)15-9-1-2-10-15/h3,5,7H,1-2,4,6,8-10H2 |
| InChIKey | QBQIUDYFPJQEDQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one (CID 105422231) is 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one is O=C1CCCc2cccc(N3CCCC3)c21.
What is the InChIKey of 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is QBQIUDYFPJQEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c16-13-8-4-6-11-5-3-7-12(14(11)13)15-9-1-2-10-15/h3,5,7H,1-2,4,6,8-10H2.
What are the key properties of 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one?
8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 215.30 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pyrrolidin-1-yl-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 105422231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).