C19H28N2O — CID 10542265
(4R,5S)-1,5-dimethyl-3-[(4R)-6-methylhept-1-en-4-yl]-4-phenylimidazolidin-2-one (PubChem CID 10542265) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (4R,5S)-1,5-dimethyl-3-[(4R)-6-methylhept-1-en-4-yl]-4-phenylimidazolidin-2-one.
| Compound Name | (4R,5S)-1,5-dimethyl-3-[(4R)-6-methylhept-1-en-4-yl]-4-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 10542265 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (4R,5S)-1,5-dimethyl-3-[(4R)-6-methylhept-1-en-4-yl]-4-phenylimidazolidin-2-one |
| SMILES | C=CC[C@@H](CC(C)C)N1C(=O)N(C)[C@@H](C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H28N2O/c1-6-10-17(13-14(2)3)21-18(15(4)20(5)19(21)22)16-11-8-7-9-12-16/h6-9,11-12,14-15,17-18H,1,10,13H2,2-5H3/t15-,17-,18-/m0/s1 |
| InChIKey | CLHLWZJGITWBAZ-SZMVWBNQSA-N |
| XLogP | 4.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|