C17H24N2O — CID 10730915
(4S,5R)-1-[(3R)-hex-5-en-3-yl]-3,4-dimethyl-5-phenylimidazolidin-2-one (PubChem CID 10730915) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (4S,5R)-1-[(3R)-hex-5-en-3-yl]-3,4-dimethyl-5-phenylimidazolidin-2-one.
| Compound Name | (4S,5R)-1-[(3R)-hex-5-en-3-yl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 10730915 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (4S,5R)-1-[(3R)-hex-5-en-3-yl]-3,4-dimethyl-5-phenylimidazolidin-2-one |
| SMILES | C=CCC(CC)N1C(=O)N(C)[C@@H](C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H24N2O/c1-5-10-15(6-2)19-16(13(3)18(4)17(19)20)14-11-8-7-9-12-14/h5,7-9,11-13,15-16H,1,6,10H2,2-4H3/t13-,15?,16-/m0/s1 |
| InChIKey | QWLYKIHRZBJDBN-VFDRBLODSA-N |
| XLogP | 3.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|