C16H13ClN2O2 — CID 10542283
2-chloro-5,7-dimethoxy-3-phenylquinoxaline (PubChem CID 10542283) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is 2-chloro-5,7-dimethoxy-3-phenylquinoxaline.
| Compound Name | 2-chloro-5,7-dimethoxy-3-phenylquinoxaline |
|---|---|
| PubChem CID | 10542283 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-chloro-5,7-dimethoxy-3-phenylquinoxaline |
| SMILES | COc1cc(OC)c2nc(-c3ccccc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C16H13ClN2O2/c1-20-11-8-12-15(13(9-11)21-2)19-14(16(17)18-12)10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | KGFOGXRYKPGKGX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |