C10H9BrF2O2S — CID 105424866
2-(3-bromo-4-ethylsulfanylphenyl)-2,2-difluoroacetic acid (PubChem CID 105424866) has the molecular formula C10H9BrF2O2S and a molecular weight of 311.15 g/mol. Its IUPAC name is 2-(3-bromo-4-ethylsulfanylphenyl)-2,2-difluoroacetic acid.
| Compound Name | 2-(3-bromo-4-ethylsulfanylphenyl)-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 105424866 |
| Molecular Formula | C10H9BrF2O2S |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 309.95 |
| IUPAC Name | 2-(3-bromo-4-ethylsulfanylphenyl)-2,2-difluoroacetic acid |
| SMILES | CCSc1ccc(C(F)(F)C(=O)O)cc1Br |
| InChI | InChI=1S/C10H9BrF2O2S/c1-2-16-8-4-3-6(5-7(8)11)10(12,13)9(14)15/h3-5H,2H2,1H3,(H,14,15) |
| InChIKey | HMYMAIQONNHYQR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |