C7H9ClN2O — CID 105435348
3-amino-5-chloro-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 105435348) has the molecular formula C7H9ClN2O and a molecular weight of 172.61 g/mol. Its IUPAC name is 3-amino-5-chloro-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-amino-5-chloro-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 105435348 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 3-amino-5-chloro-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)c(N)c(C)c1Cl |
| InChI | InChI=1S/C7H9ClN2O/c1-3-5(8)4(2)10-7(11)6(3)9/h9H2,1-2H3,(H,10,11) |
| InChIKey | FDJNETCWUMIBKI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |