C7H5F2NO2 — CID 105435357
4,4-difluoro-5,6-dihydrocyclopenta[d][1,2]oxazole-3-carbaldehyde (PubChem CID 105435357) has the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. Its IUPAC name is 4,4-difluoro-5,6-dihydrocyclopenta[d][1,2]oxazole-3-carbaldehyde.
| Compound Name | 4,4-difluoro-5,6-dihydrocyclopenta[d][1,2]oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 105435357 |
| Molecular Formula | C7H5F2NO2 |
| Molecular Weight | 173.12 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 4,4-difluoro-5,6-dihydrocyclopenta[d][1,2]oxazole-3-carbaldehyde |
| SMILES | O=Cc1noc2c1C(F)(F)CC2 |
| InChI | InChI=1S/C7H5F2NO2/c8-7(9)2-1-5-6(7)4(3-11)10-12-5/h3H,1-2H2 |
| InChIKey | CLXFSJZJCJJANU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.12 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|