About 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid
7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid (PubChem CID 105438527) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid.
Analyze 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid?
The IUPAC name of 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid (CID 105438527) is 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid.
What is the SMILES notation for 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid?
The canonical SMILES for 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid is O=C1CCn2cnc(C(=O)O)c2C1.
What is the InChIKey of 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid?
The InChIKey is XYCACNAFYSORPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3/c11-5-1-2-10-4-9-7(8(12)13)6(10)3-5/h4H,1-3H2,(H,12,13).
What are the key properties of 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid?
7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid has a molecular weight of 180.16 g/mol, XLogP of 0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxo-6,8-dihydro-5H-imidazo[1,5-a]pyridine-1-carboxylic acid is sourced from PubChem (CID 105438527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).