C10H19N3 — CID 105439692
[4,5-di(propan-2-yl)-1H-imidazol-2-yl]methanamine (PubChem CID 105439692) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is [4,5-di(propan-2-yl)-1H-imidazol-2-yl]methanamine.
| Compound Name | [4,5-di(propan-2-yl)-1H-imidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 105439692 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | [4,5-di(propan-2-yl)-1H-imidazol-2-yl]methanamine |
| SMILES | CC(C)c1nc(CN)[nH]c1C(C)C |
| InChI | InChI=1S/C10H19N3/c1-6(2)9-10(7(3)4)13-8(5-11)12-9/h6-7H,5,11H2,1-4H3,(H,12,13) |
| InChIKey | CDZXCWCIDIPOPY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |