C11H21N3 — CID 105449546
(4-tert-butyl-5-propan-2-yl-1H-imidazol-2-yl)methanamine (PubChem CID 105449546) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is (4-tert-butyl-5-propan-2-yl-1H-imidazol-2-yl)methanamine.
| Compound Name | (4-tert-butyl-5-propan-2-yl-1H-imidazol-2-yl)methanamine |
|---|---|
| PubChem CID | 105449546 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (4-tert-butyl-5-propan-2-yl-1H-imidazol-2-yl)methanamine |
| SMILES | CC(C)c1[nH]c(CN)nc1C(C)(C)C |
| InChI | InChI=1S/C11H21N3/c1-7(2)9-10(11(3,4)5)14-8(6-12)13-9/h7H,6,12H2,1-5H3,(H,13,14) |
| InChIKey | ZUUYOOABYWGSKG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |