C9H17N5S — CID 174265337
2-(aminomethyl)-6-propan-2-yl-1H-1,3,5-triazine-4-thione;aziridine (PubChem CID 174265337) has the molecular formula C9H17N5S and a molecular weight of 227.34 g/mol. Its IUPAC name is 2-(aminomethyl)-6-propan-2-yl-1H-1,3,5-triazine-4-thione;aziridine.
| Compound Name | 2-(aminomethyl)-6-propan-2-yl-1H-1,3,5-triazine-4-thione;aziridine |
|---|---|
| PubChem CID | 174265337 |
| Molecular Formula | C9H17N5S |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-(aminomethyl)-6-propan-2-yl-1H-1,3,5-triazine-4-thione;aziridine |
| SMILES | C1CN1.CC(C)c1nc(=S)nc(CN)[nH]1 |
| InChI | InChI=1S/C7H12N4S.C2H5N/c1-4(2)6-9-5(3-8)10-7(12)11-6;1-2-3-1/h4H,3,8H2,1-2H3,(H,9,10,11,12);3H,1-2H2 |
| InChIKey | AOOIPGUYGMMUOE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|