About 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one
3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one (PubChem CID 105442058) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one.
Analyze 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one?
The IUPAC name of 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one (CID 105442058) is 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one.
What is the SMILES notation for 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one?
The canonical SMILES for 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one is NCCN1CC2(CCOC2)OC1=O.
What is the InChIKey of 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one?
The InChIKey is PSRSOJBTWNQEPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c9-2-3-10-5-8(13-7(10)11)1-4-12-6-8/h1-6,9H2.
What are the key properties of 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one?
3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one has a molecular weight of 186.21 g/mol, XLogP of -0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-1,7-dioxa-3-azaspiro[4.4]nonan-2-one is sourced from PubChem (CID 105442058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).