C10H19N3O2 — CID 105466874
3-(2-aminoethyl)-1-oxa-3,8-diazaspiro[5.5]undecan-2-one (PubChem CID 105466874) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1-oxa-3,8-diazaspiro[5.5]undecan-2-one.
| Compound Name | 3-(2-aminoethyl)-1-oxa-3,8-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 105466874 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-(2-aminoethyl)-1-oxa-3,8-diazaspiro[5.5]undecan-2-one |
| SMILES | NCCN1CCC2(CCCNC2)OC1=O |
| InChI | InChI=1S/C10H19N3O2/c11-4-7-13-6-3-10(15-9(13)14)2-1-5-12-8-10/h12H,1-8,11H2 |
| InChIKey | WVBAMMGAOBERSC-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |