C10H9N3O — CID 105442499
2,5-dihydro-1H-imidazo[1,2-a]quinoxalin-4-one (PubChem CID 105442499) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 2,5-dihydro-1H-imidazo[1,2-a]quinoxalin-4-one.
| Compound Name | 2,5-dihydro-1H-imidazo[1,2-a]quinoxalin-4-one |
|---|---|
| PubChem CID | 105442499 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 2,5-dihydro-1H-imidazo[1,2-a]quinoxalin-4-one |
| SMILES | O=C1Nc2ccccc2N2CCN=C12 |
| InChI | InChI=1S/C10H9N3O/c14-10-9-11-5-6-13(9)8-4-2-1-3-7(8)12-10/h1-4H,5-6H2,(H,12,14) |
| InChIKey | BEYWVGROIKPHTF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |