C13H17N — CID 105442796
1-(8-methyl-3,4-dihydronaphthalen-1-yl)ethanamine (PubChem CID 105442796) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-(8-methyl-3,4-dihydronaphthalen-1-yl)ethanamine.
| Compound Name | 1-(8-methyl-3,4-dihydronaphthalen-1-yl)ethanamine |
|---|---|
| PubChem CID | 105442796 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-(8-methyl-3,4-dihydronaphthalen-1-yl)ethanamine |
| SMILES | Cc1cccc2c1C(C(C)N)=CCC2 |
| InChI | InChI=1S/C13H17N/c1-9-5-3-6-11-7-4-8-12(10(2)14)13(9)11/h3,5-6,8,10H,4,7,14H2,1-2H3 |
| InChIKey | LKIFMKWOVFKZTO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |