C16H22 — CID 144809018
4-ethyl-5-(2-methylpropyl)-1,2-dihydronaphthalene (PubChem CID 144809018) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 4-ethyl-5-(2-methylpropyl)-1,2-dihydronaphthalene.
| Compound Name | 4-ethyl-5-(2-methylpropyl)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 144809018 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 4-ethyl-5-(2-methylpropyl)-1,2-dihydronaphthalene |
| SMILES | CCC1=CCCc2cccc(CC(C)C)c21 |
| InChI | InChI=1S/C16H22/c1-4-13-7-5-8-14-9-6-10-15(16(13)14)11-12(2)3/h6-7,9-10,12H,4-5,8,11H2,1-3H3 |
| InChIKey | WDTVZRLMIKYOPH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |