C12H15N — CID 105435595
(8-methyl-3,4-dihydronaphthalen-1-yl)methanamine (PubChem CID 105435595) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (8-methyl-3,4-dihydronaphthalen-1-yl)methanamine.
| Compound Name | (8-methyl-3,4-dihydronaphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 105435595 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (8-methyl-3,4-dihydronaphthalen-1-yl)methanamine |
| SMILES | Cc1cccc2c1C(CN)=CCC2 |
| InChI | InChI=1S/C12H15N/c1-9-4-2-5-10-6-3-7-11(8-13)12(9)10/h2,4-5,7H,3,6,8,13H2,1H3 |
| InChIKey | WILGCDMJWCGLNC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |