C11H12FN — CID 13340039
(5-fluoro-3,4-dihydronaphthalen-1-yl)methanamine (PubChem CID 13340039) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is (5-fluoro-3,4-dihydronaphthalen-1-yl)methanamine.
| Compound Name | (5-fluoro-3,4-dihydronaphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 13340039 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (5-fluoro-3,4-dihydronaphthalen-1-yl)methanamine |
| SMILES | NCC1=CCCc2c(F)cccc21 |
| InChI | InChI=1S/C11H12FN/c12-11-6-2-4-9-8(7-13)3-1-5-10(9)11/h2-4,6H,1,5,7,13H2 |
| InChIKey | UKJXNRLDIBYCOW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |