About 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine
1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine (PubChem CID 121004232) has the molecular formula C13H14FN
and a molecular weight of 203.26 g/mol. Its IUPAC name is 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine |
| PubChem CID | 121004232 |
| Molecular Formula | C13H14FN |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine |
| SMILES | NC1(C2=CCCc3c(F)cccc32)CC1 |
| InChI | InChI=1S/C13H14FN/c14-12-6-2-3-9-10(12)4-1-5-11(9)13(15)7-8-13/h2-3,5-6H,1,4,7-8,15H2 |
| InChIKey | CLHNKWKEBXEYKF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine?
The IUPAC name of 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine (CID 121004232) is 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine.
What is the SMILES notation for 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine?
The canonical SMILES for 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine is NC1(C2=CCCc3c(F)cccc32)CC1.
What is the InChIKey of 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine?
The InChIKey is CLHNKWKEBXEYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN/c14-12-6-2-3-9-10(12)4-1-5-11(9)13(15)7-8-13/h2-3,5-6H,1,4,7-8,15H2.
What are the key properties of 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine?
1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine has a molecular weight of 203.26 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluoro-3,4-dihydronaphthalen-1-yl)cyclopropan-1-amine is sourced from PubChem (CID 121004232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).