C18H15F — CID 174264510
7-fluoro-3,4,5,6-tetrahydrochrysene (PubChem CID 174264510) has the molecular formula C18H15F and a molecular weight of 250.32 g/mol. Its IUPAC name is 7-fluoro-3,4,5,6-tetrahydrochrysene.
| Compound Name | 7-fluoro-3,4,5,6-tetrahydrochrysene |
|---|---|
| PubChem CID | 174264510 |
| Molecular Formula | C18H15F |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 7-fluoro-3,4,5,6-tetrahydrochrysene |
| SMILES | Fc1cccc2c1CCc1c-2ccc2c1CCC=C2 |
| InChI | InChI=1S/C18H15F/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18/h1,3-4,6-9H,2,5,10-11H2 |
| InChIKey | MCWLZGVHCQGNEC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |