C22H20N2O — CID 174480869
1H-pyrimidin-6-one;3,4,5,6-tetrahydrochrysene (PubChem CID 174480869) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is 1H-pyrimidin-6-one;3,4,5,6-tetrahydrochrysene.
| Compound Name | 1H-pyrimidin-6-one;3,4,5,6-tetrahydrochrysene |
|---|---|
| PubChem CID | 174480869 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1H-pyrimidin-6-one;3,4,5,6-tetrahydrochrysene |
| SMILES | C1=Cc2ccc3c(c2CC1)CCc1ccccc1-3.O=c1ccnc[nH]1 |
| InChI | InChI=1S/C18H16.C4H4N2O/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;7-4-1-2-5-3-6-4/h1-3,5-7,10,12H,4,8-9,11H2;1-3H,(H,5,6,7) |
| InChIKey | CCATVTDDATXTKS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |