C23H20N4 — CID 175316271
7H-purine;3,4,5,6-tetrahydrochrysene (PubChem CID 175316271) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 7H-purine;3,4,5,6-tetrahydrochrysene.
| Compound Name | 7H-purine;3,4,5,6-tetrahydrochrysene |
|---|---|
| PubChem CID | 175316271 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 7H-purine;3,4,5,6-tetrahydrochrysene |
| SMILES | C1=Cc2ccc3c(c2CC1)CCc1ccccc1-3.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C18H16.C5H4N4/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-4-5(8-2-6-1)9-3-7-4/h1-3,5-7,10,12H,4,8-9,11H2;1-3H,(H,6,7,8,9) |
| InChIKey | PMJHPVWWBJNZKX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |