C11H12ClN — CID 82277158
(7-chloro-3,4-dihydronaphthalen-1-yl)methanamine (PubChem CID 82277158) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is (7-chloro-3,4-dihydronaphthalen-1-yl)methanamine.
| Compound Name | (7-chloro-3,4-dihydronaphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 82277158 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (7-chloro-3,4-dihydronaphthalen-1-yl)methanamine |
| SMILES | NCC1=CCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H12ClN/c12-10-5-4-8-2-1-3-9(7-13)11(8)6-10/h3-6H,1-2,7,13H2 |
| InChIKey | SGXPKSJNZURJJP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |