C12H14FN — CID 105445138
1-(7-fluoro-3,4-dihydronaphthalen-2-yl)ethanamine (PubChem CID 105445138) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is 1-(7-fluoro-3,4-dihydronaphthalen-2-yl)ethanamine.
| Compound Name | 1-(7-fluoro-3,4-dihydronaphthalen-2-yl)ethanamine |
|---|---|
| PubChem CID | 105445138 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(7-fluoro-3,4-dihydronaphthalen-2-yl)ethanamine |
| SMILES | CC(N)C1=Cc2cc(F)ccc2CC1 |
| InChI | InChI=1S/C12H14FN/c1-8(14)10-3-2-9-4-5-12(13)7-11(9)6-10/h4-8H,2-3,14H2,1H3 |
| InChIKey | JPVPPBFRVQIROO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |