C10H9FN2O — CID 105445734
[4-(3-fluorophenyl)-1,3-oxazol-2-yl]methanamine (PubChem CID 105445734) has the molecular formula C10H9FN2O and a molecular weight of 192.19 g/mol. Its IUPAC name is [4-(3-fluorophenyl)-1,3-oxazol-2-yl]methanamine.
| Compound Name | [4-(3-fluorophenyl)-1,3-oxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 105445734 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | [4-(3-fluorophenyl)-1,3-oxazol-2-yl]methanamine |
| SMILES | NCc1nc(-c2cccc(F)c2)co1 |
| InChI | InChI=1S/C10H9FN2O/c11-8-3-1-2-7(4-8)9-6-14-10(5-12)13-9/h1-4,6H,5,12H2 |
| InChIKey | ULQXWCSFHTXOEM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |