3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid

C9H13N3O2 — CID 105448912

IUPAC3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid
SMILESCc1nnc(CC(C)C(=O)O)nc1C
InChIInChI=1S/C9H13N3O2/c1-5(9(13)14)4-8-10-6(2)7(3)11-12-8/h5H,4H2,1-3H3,(H,13,14)
InChIKeyBSLTZDLRFRGFAE-UHFFFAOYSA-N
MW195.22 g/mol
LogP0.75
Rot. Bonds3

About 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid

3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid (PubChem CID 105448912) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid
PubChem CID105448912
Molecular FormulaC9H13N3O2
Molecular Weight195.22 g/mol
Exact Mass195.10
IUPAC Name3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid
SMILESCc1nnc(CC(C)C(=O)O)nc1C
InChIInChI=1S/C9H13N3O2/c1-5(9(13)14)4-8-10-6(2)7(3)11-12-8/h5H,4H2,1-3H3,(H,13,14)
InChIKeyBSLTZDLRFRGFAE-UHFFFAOYSA-N
XLogP0.75
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.22
LogP ≤ 50.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid (CID 105448912) is 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid is Cc1nnc(CC(C)C(=O)O)nc1C.
What is the InChIKey of 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid?
The InChIKey is BSLTZDLRFRGFAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-5(9(13)14)4-8-10-6(2)7(3)11-12-8/h5H,4H2,1-3H3,(H,13,14).
What are the key properties of 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid?
3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid has a molecular weight of 195.22 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanoic acid is sourced from PubChem (CID 105448912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).