C11H9N3O — CID 105451996
5-(3-methylphenyl)-1,2,4-triazine-3-carbaldehyde (PubChem CID 105451996) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 5-(3-methylphenyl)-1,2,4-triazine-3-carbaldehyde.
| Compound Name | 5-(3-methylphenyl)-1,2,4-triazine-3-carbaldehyde |
|---|---|
| PubChem CID | 105451996 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 5-(3-methylphenyl)-1,2,4-triazine-3-carbaldehyde |
| SMILES | Cc1cccc(-c2cnnc(C=O)n2)c1 |
| InChI | InChI=1S/C11H9N3O/c1-8-3-2-4-9(5-8)10-6-12-14-11(7-15)13-10/h2-7H,1H3 |
| InChIKey | KKWIYDUGOUOLIA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|