C12H13FN2 — CID 105456218
2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-amine (PubChem CID 105456218) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-amine.
| Compound Name | 2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-amine |
|---|---|
| PubChem CID | 105456218 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-amine |
| SMILES | NC1CCn2c(cc3cc(F)ccc32)C1 |
| InChI | InChI=1S/C12H13FN2/c13-9-1-2-12-8(5-9)6-11-7-10(14)3-4-15(11)12/h1-2,5-6,10H,3-4,7,14H2 |
| InChIKey | FCEQKCWQLBILHO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |