C12H12FNO — CID 115023942
2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-ol (PubChem CID 115023942) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is 2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-ol.
| Compound Name | 2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-ol |
|---|---|
| PubChem CID | 115023942 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-8-ol |
| SMILES | OC1CCn2c(cc3cc(F)ccc32)C1 |
| InChI | InChI=1S/C12H12FNO/c13-9-1-2-12-8(5-9)6-10-7-11(15)3-4-14(10)12/h1-2,5-6,11,15H,3-4,7H2 |
| InChIKey | ZVMKZMUWIAGHOO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |