C19H21N5S — CID 10545897
1-butyl-3-[(3-phenylquinoxalin-2-yl)amino]thiourea (PubChem CID 10545897) has the molecular formula C19H21N5S and a molecular weight of 351.48 g/mol. Its IUPAC name is 1-butyl-3-[(3-phenylquinoxalin-2-yl)amino]thiourea.
| Compound Name | 1-butyl-3-[(3-phenylquinoxalin-2-yl)amino]thiourea |
|---|---|
| PubChem CID | 10545897 |
| Molecular Formula | C19H21N5S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-butyl-3-[(3-phenylquinoxalin-2-yl)amino]thiourea |
| SMILES | CCCCNC(=S)NNc1nc2ccccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C19H21N5S/c1-2-3-13-20-19(25)24-23-18-17(14-9-5-4-6-10-14)21-15-11-7-8-12-16(15)22-18/h4-12H,2-3,13H2,1H3,(H,22,23)(H2,20,24,25) |
| InChIKey | FPLIANXOUYYTNZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|