C12H18N2O — CID 105459379
4-(propan-2-ylamino)-1,2,3,4-tetrahydroquinolin-7-ol (PubChem CID 105459379) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-(propan-2-ylamino)-1,2,3,4-tetrahydroquinolin-7-ol.
| Compound Name | 4-(propan-2-ylamino)-1,2,3,4-tetrahydroquinolin-7-ol |
|---|---|
| PubChem CID | 105459379 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-(propan-2-ylamino)-1,2,3,4-tetrahydroquinolin-7-ol |
| SMILES | CC(C)NC1CCNc2cc(O)ccc21 |
| InChI | InChI=1S/C12H18N2O/c1-8(2)14-11-5-6-13-12-7-9(15)3-4-10(11)12/h3-4,7-8,11,13-15H,5-6H2,1-2H3 |
| InChIKey | VKPYQPLFQYFXQO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |