C11H16N2O — CID 105446267
4-(dimethylamino)-1,2,3,4-tetrahydroquinolin-7-ol (PubChem CID 105446267) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(dimethylamino)-1,2,3,4-tetrahydroquinolin-7-ol.
| Compound Name | 4-(dimethylamino)-1,2,3,4-tetrahydroquinolin-7-ol |
|---|---|
| PubChem CID | 105446267 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 4-(dimethylamino)-1,2,3,4-tetrahydroquinolin-7-ol |
| SMILES | CN(C)C1CCNc2cc(O)ccc21 |
| InChI | InChI=1S/C11H16N2O/c1-13(2)11-5-6-12-10-7-8(14)3-4-9(10)11/h3-4,7,11-12,14H,5-6H2,1-2H3 |
| InChIKey | DHOAYZKKWFFHTA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |