About 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine
1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine (PubChem CID 105461387) has the molecular formula C12H14ClN
and a molecular weight of 207.70 g/mol. Its IUPAC name is 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine |
| PubChem CID | 105461387 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine |
| SMILES | CNCC1=Cc2cc(Cl)ccc2CC1 |
| InChI | InChI=1S/C12H14ClN/c1-14-8-9-2-3-10-4-5-12(13)7-11(10)6-9/h4-7,14H,2-3,8H2,1H3 |
| InChIKey | FMPGHHNDRAITDA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine?
The IUPAC name of 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine (CID 105461387) is 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine?
The canonical SMILES for 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine is CNCC1=Cc2cc(Cl)ccc2CC1.
What is the InChIKey of 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine?
The InChIKey is FMPGHHNDRAITDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN/c1-14-8-9-2-3-10-4-5-12(13)7-11(10)6-9/h4-7,14H,2-3,8H2,1H3.
What are the key properties of 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine?
1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine has a molecular weight of 207.70 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-chloro-3,4-dihydronaphthalen-2-yl)-N-methylmethanamine is sourced from PubChem (CID 105461387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).