C12H13FO2 — CID 105461602
5-fluoro-2-methoxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde (PubChem CID 105461602) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde.
| Compound Name | 5-fluoro-2-methoxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 105461602 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 5-fluoro-2-methoxy-3,4-dihydro-1H-naphthalene-2-carbaldehyde |
| SMILES | COC1(C=O)CCc2c(F)cccc2C1 |
| InChI | InChI=1S/C12H13FO2/c1-15-12(8-14)6-5-10-9(7-12)3-2-4-11(10)13/h2-4,8H,5-7H2,1H3 |
| InChIKey | KYZNWGCXAKSWFT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|