C10H15N3O2 — CID 105462961
2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid (PubChem CID 105462961) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid.
| Compound Name | 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 105462961 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1nncc(C(C)(C)C)n1 |
| InChI | InChI=1S/C10H15N3O2/c1-6(9(14)15)8-12-7(5-11-13-8)10(2,3)4/h5-6H,1-4H3,(H,14,15) |
| InChIKey | QDSUUZXSSOYKNK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |