2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid

C10H15N3O2 — CID 105462961

IUPAC2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid
SMILESCC(C(=O)O)c1nncc(C(C)(C)C)n1
InChIInChI=1S/C10H15N3O2/c1-6(9(14)15)8-12-7(5-11-13-8)10(2,3)4/h5-6H,1-4H3,(H,14,15)
InChIKeyQDSUUZXSSOYKNK-UHFFFAOYSA-N
MW209.25 g/mol
LogP1.36
Rot. Bonds2

About 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid

2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid (PubChem CID 105462961) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid.

Molecular Properties

Compound Name2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid
PubChem CID105462961
Molecular FormulaC10H15N3O2
Molecular Weight209.25 g/mol
Exact Mass209.12
IUPAC Name2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid
SMILESCC(C(=O)O)c1nncc(C(C)(C)C)n1
InChIInChI=1S/C10H15N3O2/c1-6(9(14)15)8-12-7(5-11-13-8)10(2,3)4/h5-6H,1-4H3,(H,14,15)
InChIKeyQDSUUZXSSOYKNK-UHFFFAOYSA-N
XLogP1.36
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.25
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid?
The IUPAC name of 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid (CID 105462961) is 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid.
What is the SMILES notation for 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid?
The canonical SMILES for 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid is CC(C(=O)O)c1nncc(C(C)(C)C)n1.
What is the InChIKey of 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid?
The InChIKey is QDSUUZXSSOYKNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-6(9(14)15)8-12-7(5-11-13-8)10(2,3)4/h5-6H,1-4H3,(H,14,15).
What are the key properties of 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid?
2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid has a molecular weight of 209.25 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-tert-butyl-1,2,4-triazin-3-yl)propanoic acid is sourced from PubChem (CID 105462961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).