C20H21F3N2O — CID 10546572
(3R)-4,4,4-trifluoro-N-[(1S)-1-phenylethyl]-3-(1-phenylethylideneamino)butanamide (PubChem CID 10546572) has the molecular formula C20H21F3N2O and a molecular weight of 362.40 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-N-[(1S)-1-phenylethyl]-3-(1-phenylethylideneamino)butanamide.
| Compound Name | (3R)-4,4,4-trifluoro-N-[(1S)-1-phenylethyl]-3-(1-phenylethylideneamino)butanamide |
|---|---|
| PubChem CID | 10546572 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (3R)-4,4,4-trifluoro-N-[(1S)-1-phenylethyl]-3-(1-phenylethylideneamino)butanamide |
| SMILES | C/C(=N\[C@H](CC(=O)N[C@@H](C)c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C20H21F3N2O/c1-14(16-9-5-3-6-10-16)24-18(20(21,22)23)13-19(26)25-15(2)17-11-7-4-8-12-17/h3-12,15,18H,13H2,1-2H3,(H,25,26)/b24-14+/t15-,18+/m0/s1 |
| InChIKey | WAPINGZGVJRTRQ-AXRFVUJLSA-N |
| XLogP | 4.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|