About 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol
3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol (PubChem CID 105470561) has the molecular formula C7H9BrN2O
and a molecular weight of 217.07 g/mol. Its IUPAC name is 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol.
Analyze 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol?
The IUPAC name of 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol (CID 105470561) is 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol.
What is the SMILES notation for 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol?
The canonical SMILES for 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol is OC1CCCn2c(Br)cnc21.
What is the InChIKey of 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol?
The InChIKey is BOSKCKSGQMXXQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2O/c8-6-4-9-7-5(11)2-1-3-10(6)7/h4-5,11H,1-3H2.
What are the key properties of 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol?
3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol has a molecular weight of 217.07 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ol is sourced from PubChem (CID 105470561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).